ChemNet > CAS > 33786-89-9 5-Chloro-m-phenylenediamine
33786-89-9 5-Chloro-m-phenylenediamine
| שם המוצר |
5-Chloro-m-phenylenediamine |
| נרדפות |
5-Chloro-1,3-diaminobenzene; 5-chlorobenzene-1,3-diamine |
| מולקולרית פורמולה |
C6H7ClN2 |
| משקל מולקולרי |
142.5862 |
| InChI |
InChI=1/C6H7ClN2/c7-4-1-5(8)3-6(9)2-4/h1-3H,8-9H2 |
| מספר CAS |
33786-89-9 |
| מבנה מולקולרי |
|
| צפיפות |
1.345g/cm3 |
| נקודת רתיחה |
333.6°C at 760 mmHg |
| משקל סגולי |
1.67 |
| נקודת הבזק |
155.6°C |
| Hazard סימנים |
|
| סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
| בטיחות תיאור |
S22:Do not inhale dust.;
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
