ChemNet > CAS > 33901-44-9 4-Methylphenoxyacetonitrile
33901-44-9 4-Methylphenoxyacetonitrile
שם המוצר |
4-Methylphenoxyacetonitrile |
מולקולרית פורמולה |
C9H9NO |
משקל מולקולרי |
147.1739 |
InChI |
InChI=1/C9H9NO/c1-8-2-4-9(5-3-8)11-7-6-10/h2-5H,7H2,1H3 |
מספר CAS |
33901-44-9 |
מבנה מולקולרי |
|
צפיפות |
1.054g/cm3 |
נקודת רתיחה |
262.5°C at 760 mmHg |
משקל סגולי |
1.517 |
נקודת הבזק |
109.8°C |
Hazard סימנים |
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|