ChemNet > CAS > 374537-99-2 7-Amino-5-bromoindole
374537-99-2 7-Amino-5-bromoindole
שם המוצר |
7-Amino-5-bromoindole |
נרדפות |
5-Bromo-7-indolamine; 5-bromo-1H-indol-7-amine |
מולקולרית פורמולה |
C8H7BrN2 |
משקל מולקולרי |
211.0586 |
InChI |
InChI=1/C8H7BrN2/c9-6-3-5-1-2-11-8(5)7(10)4-6/h1-4,11H,10H2 |
מספר CAS |
374537-99-2 |
מבנה מולקולרי |
|
צפיפות |
1.753g/cm3 |
נקודת רתיחה |
405.6°C at 760 mmHg |
משקל סגולי |
1.779 |
נקודת הבזק |
199.1°C |
Hazard סימנים |
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|