ChemNet > CAS > 39593-08-3 Methylphenylpiperazine
39593-08-3 Methylphenylpiperazine
שם המוצר |
Methylphenylpiperazine |
נרדפות |
1-(4-Methylphenyl)piperazine; N-(p-Tolyl)piperazine; 1-p-tolylpiperazine |
מולקולרית פורמולה |
C11H16N2 |
משקל מולקולרי |
176.2581 |
InChI |
InChI=1/C11H16N2/c1-10-2-4-11(5-3-10)13-8-6-12-7-9-13/h2-5,12H,6-9H2,1H3 |
מספר CAS |
39593-08-3 |
EINECS |
254-534-6 |
מבנה מולקולרי |
|
צפיפות |
1.012g/cm3 |
נקודת רתיחה |
321.2°C at 760 mmHg |
משקל סגולי |
1.54 |
נקודת הבזק |
153.8°C |
Hazard סימנים |
Xi:Irritant;
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|