ChemNet > CAS > 42877-08-7 2-Acetyl-3-bromothiophene
42877-08-7 2-Acetyl-3-bromothiophene
| שם המוצר |
2-Acetyl-3-bromothiophene |
| נרדפות |
1-(3-bromothiophen-2-yl)ethanone |
| מולקולרית פורמולה |
C6H5BrOS |
| משקל מולקולרי |
205.0723 |
| InChI |
InChI=1/C6H5BrOS/c1-4(8)6-5(7)2-3-9-6/h2-3H,1H3 |
| מספר CAS |
42877-08-7 |
| מבנה מולקולרי |
|
| צפיפות |
1.619g/cm3 |
| נקודת רתיחה |
283.5°C at 760 mmHg |
| משקל סגולי |
1.583 |
| נקודת הבזק |
125.3°C |
| Hazard סימנים |
|
| סיכונים קודי |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
