ChemNet > CAS > 4410-12-2 1-Benzylhomopiperazine
4410-12-2 1-Benzylhomopiperazine
| שם המוצר |
1-Benzylhomopiperazine |
| נרדפות |
1-Benzylhexahydro-1,4-diazepine; N-benzylhomopiperazine; 1-benzyl-1,4-diazepane; 1-Benzyl-1,4-diazacycloheptane; 1-Benzyl-1,4-diazacycloheptanel |
| מולקולרית פורמולה |
C12H18N2 |
| משקל מולקולרי |
190.2847 |
| InChI |
InChI=1/C12H18N2/c1-2-5-12(6-3-1)11-14-9-4-7-13-8-10-14/h1-3,5-6,13H,4,7-11H2 |
| מספר CAS |
4410-12-2 |
| מבנה מולקולרי |
|
| צפיפות |
1.003g/cm3 |
| נקודת רתיחה |
286.5°C at 760 mmHg |
| משקל סגולי |
1.536 |
| נקודת הבזק |
116.2°C |
| Hazard סימנים |
|
| סיכונים קודי |
R34:Causes burns.;
|
| בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
