ChemNet > CAS > 4693-91-8 4-methoxyphenylacetyl chloride
4693-91-8 4-methoxyphenylacetyl chloride
שם המוצר |
4-methoxyphenylacetyl chloride |
נרדפות |
Benzenacetyl chloride, 4-methoxy-; (p-Methoxyphenyl)acetyl chloride; (4-Methoxyphenyl)acetylchloride |
מולקולרית פורמולה |
C9H9ClO2 |
משקל מולקולרי |
184.6196 |
InChI |
InChI=1/C9H9ClO2/c1-12-8-4-2-7(3-5-8)6-9(10)11/h2-5H,6H2,1H3 |
מספר CAS |
4693-91-8 |
מבנה מולקולרי |
|
צפיפות |
1.192g/cm3 |
נקודת רתיחה |
280.1°C at 760 mmHg |
משקל סגולי |
1.524 |
נקודת הבזק |
100°C |
Hazard סימנים |
C:Corrosive;
|
סיכונים קודי |
R34:Causes burns.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|