ChemNet > CAS > 499770-77-3 (1-Methyl-1H-1,2,3-benzotriazol-5-yl)methylamine
499770-77-3 (1-Methyl-1H-1,2,3-benzotriazol-5-yl)methylamine
| שם המוצר |
(1-Methyl-1H-1,2,3-benzotriazol-5-yl)methylamine |
| נרדפות |
1-(1-methyl-1H-benzotriazol-5-yl)methanamine |
| מולקולרית פורמולה |
C8H10N4 |
| משקל מולקולרי |
162.1918 |
| InChI |
InChI=1/C8H10N4/c1-12-8-3-2-6(5-9)4-7(8)10-11-12/h2-4H,5,9H2,1H3 |
| מספר CAS |
499770-77-3 |
| מבנה מולקולרי |
|
| צפיפות |
1.34g/cm3 |
| נקודת ההתוך |
63℃ |
| נקודת רתיחה |
350.7°C at 760 mmHg |
| משקל סגולי |
1.691 |
| נקודת הבזק |
165.9°C |
| Hazard סימנים |
 C:Corrosive;
|
| סיכונים קודי |
R20:Harmful by inhalation.;
R34:Causes burns.;
|
| בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
