ChemNet > CAS > 51632-28-1 4-Ethylphenylacetonitrile
51632-28-1 4-Ethylphenylacetonitrile
| שם המוצר |
4-Ethylphenylacetonitrile |
| נרדפות |
4-Ethylbenzyl cyanide |
| מולקולרית פורמולה |
C10H11N |
| משקל מולקולרי |
145.201 |
| InChI |
InChI=1/C10H11N/c1-2-9-3-5-10(6-4-9)7-8-11/h3-6H,2,7H2,1H3 |
| מספר CAS |
51632-28-1 |
| מבנה מולקולרי |
|
| צפיפות |
0.978g/cm3 |
| נקודת רתיחה |
252.8°C at 760 mmHg |
| משקל סגולי |
1.521 |
| נקודת הבזק |
116.1°C |
| Hazard סימנים |
|
| סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
|
|
