ChemNet > CAS > 51676-74-5 5-Chloro-2,4-dinitrotoluene
51676-74-5 5-Chloro-2,4-dinitrotoluene
| שם המוצר |
5-Chloro-2,4-dinitrotoluene |
| נרדפות |
3-Chloro-4,6-dinitrotoluene; 1-chloro-5-methyl-2,4-dinitrobenzene |
| מולקולרית פורמולה |
C7H5ClN2O4 |
| משקל מולקולרי |
216.5786 |
| InChI |
InChI=1/C7H5ClN2O4/c1-4-2-5(8)7(10(13)14)3-6(4)9(11)12/h2-3H,1H3 |
| מספר CAS |
51676-74-5 |
| מבנה מולקולרי |
|
| צפיפות |
1.532g/cm3 |
| נקודת רתיחה |
334°C at 760 mmHg |
| משקל סגולי |
1.61 |
| נקודת הבזק |
155.8°C |
| Hazard סימנים |
|
| סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
