ChemNet > CAS > 60075-23-2 3,4-Dimethoxyphenylacetic acid hydrazide
60075-23-2 3,4-Dimethoxyphenylacetic acid hydrazide
| שם המוצר |
3,4-Dimethoxyphenylacetic acid hydrazide |
| נרדפות |
3,4-Dimethoxyphenylacethydrazide~Homoveratric acid hydrazide; 2-(3,4-dimethoxyphenyl)acetohydrazide |
| מולקולרית פורמולה |
C10H14N2O3 |
| משקל מולקולרי |
210.2298 |
| InChI |
InChI=1/C10H14N2O3/c1-14-8-4-3-7(5-9(8)15-2)6-10(13)12-11/h3-5H,6,11H2,1-2H3,(H,12,13) |
| מספר CAS |
60075-23-2 |
| מבנה מולקולרי |
|
| צפיפות |
1.168g/cm3 |
| נקודת רתיחה |
420.3°C at 760 mmHg |
| משקל סגולי |
1.538 |
| נקודת הבזק |
208°C |
| Hazard סימנים |
|
| סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
