ChemNet > CAS > 602-87-9 5-Nitroacenaphthene
602-87-9 5-Nitroacenaphthene
שם המוצר |
5-Nitroacenaphthene |
נרדפות |
1,2-Dihydro-5-nitro-acenaphthylene; 4-05-00-01840 (Beilstein Handbook Reference); 5-Nan; 5-Nitroacenaphthylene; 5-Nitroacenapthene; 5-Nitronaphthalene; 5-Nitronaphthalene ethylene; Acenaphthene, 5-nitro-; Acenaphthylene, 1,2-dihydro-5-nitro-; BRN 1876864; CCRIS 438; HSDB 4092; NCI-C01967; NSC 1312; NSC 22421; 1,2-Dihydro-5-nitroacenaphthylene; 5-nitro-1,2-dihydroacenaphthylene; Nitroacenaphthene; 1,2-dihydro-5-nitro-acenaphthylen |
מולקולרית פורמולה |
C12H7NO2 |
משקל מולקולרי |
197.1895 |
InChI |
InChI=1/C12H7NO2/c14-13(15)11-7-6-9-5-4-8-2-1-3-10(11)12(8)9/h1-7H |
מספר CAS |
602-87-9 |
EINECS |
210-025-0 |
מבנה מולקולרי |
|
צפיפות |
1.408g/cm3 |
נקודת ההתוך |
101-102℃ |
נקודת רתיחה |
381.6°C at 760 mmHg |
משקל סגולי |
1.763 |
נקודת הבזק |
196.7°C |
Hazard סימנים |
|
סיכונים קודי |
R45:May cause cancer.;
|
בטיחות תיאור |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|