ChemNet > CAS > 615-94-1 2,5-Dihydroxy-1,4-benzoquinone
615-94-1 2,5-Dihydroxy-1,4-benzoquinone
שם המוצר |
2,5-Dihydroxy-1,4-benzoquinone |
נרדפות |
2,5-Dihydroxybenzoquinone; 2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
מולקולרית פורמולה |
C6H4O4 |
משקל מולקולרי |
140.0936 |
InChI |
InChI=1/C6H4O4/c7-3-1-4(8)6(10)2-5(3)9/h1-2,7,10H |
מספר CAS |
615-94-1 |
EINECS |
210-454-3 |
מבנה מולקולרי |
|
צפיפות |
1.843g/cm3 |
נקודת ההתוך |
220℃ |
נקודת רתיחה |
322.3°C at 760 mmHg |
משקל סגולי |
1.729 |
נקודת הבזק |
162.9°C |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
|
|