ChemNet > CAS > 64910-46-9 3-amino-4-(methylamino)benzonitrile
64910-46-9 3-amino-4-(methylamino)benzonitrile
שם המוצר |
3-amino-4-(methylamino)benzonitrile |
מולקולרית פורמולה |
C8H9N3 |
משקל מולקולרי |
147.1772 |
InChI |
InChI=1/C8H9N3/c1-11-8-3-2-6(5-9)4-7(8)10/h2-4,11H,10H2,1H3 |
מספר CAS |
64910-46-9 |
מבנה מולקולרי |
|
צפיפות |
1.155g/cm3 |
נקודת ההתוך |
136℃ |
נקודת רתיחה |
346.783°C at 760 mmHg |
משקל סגולי |
1.593 |
נקודת הבזק |
163.529°C |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
|
|