ChemNet > CAS > 656-42-8 2,2-Difluoro-1,3-benzodioxole-5-carboxaldehyde
656-42-8 2,2-Difluoro-1,3-benzodioxole-5-carboxaldehyde
שם המוצר |
2,2-Difluoro-1,3-benzodioxole-5-carboxaldehyde |
נרדפות |
2,2-Difluoro-5-formyl-1,3-benzodioxole; 2,2-difluoro-1,3-benzodioxole-5-carbaldehyde; 2,2-Difluorobenzodioxole-5-Carboxaldehyde; 2,2-Difluoro-5-formylbenzodioxole;
|
מולקולרית פורמולה |
C8H4F2O3 |
משקל מולקולרי |
186.1124 |
InChI |
InChI=1/C8H4F2O3/c9-8(10)12-6-2-1-5(4-11)3-7(6)13-8/h1-4H |
מספר CAS |
656-42-8 |
מבנה מולקולרי |
|
צפיפות |
1.5g/cm3 |
נקודת רתיחה |
210.5°C at 760 mmHg |
משקל סגולי |
1.525 |
נקודת הבזק |
79.1°C |
Hazard סימנים |
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|