ChemNet > CAS > 699-18-3 2-(2-nitrovinyl)furan
699-18-3 2-(2-nitrovinyl)furan
שם המוצר |
2-(2-nitrovinyl)furan |
נרדפות |
|
מולקולרית פורמולה |
C6H5NO3 |
משקל מולקולרי |
139.11 |
InChI |
InChI=1/C6H5NO3/c8-7(9)4-3-6-2-1-5-10-6/h1-5H/b4-3+ |
מספר CAS |
699-18-3 |
מבנה מולקולרי |
|
נקודת ההתוך |
72-75℃ |
Hazard סימנים |
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|