ChemNet > CAS > 824-69-1 2,5-Dichlorohydroquinone
824-69-1 2,5-Dichlorohydroquinone
| שם המוצר |
2,5-Dichlorohydroquinone |
| נרדפות |
2,5-Dichloro-1,4-dihydroxybenzene; 2,5-Dichloro-1,4-hydroquinone; 2,5-Dichloro-p-benzohydroquinone; 2,5-Dichloro-p-hydroquinone; CCRIS 5677; NSC 48667; 1,4-Benzenediol, 2,5-dichloro-; Hydroquinone, 2,5-dichloro- (8CI); 2,5-dichlorobenzene-1,4-diol |
| מולקולרית פורמולה |
C6H4Cl2O2 |
| משקל מולקולרי |
179.0008 |
| InChI |
InChI=1/C6H4Cl2O2/c7-3-1-5(9)4(8)2-6(3)10/h1-2,9-10H |
| מספר CAS |
824-69-1 |
| EINECS |
212-533-8 |
| מבנה מולקולרי |
|
| צפיפות |
1.624g/cm3 |
| נקודת ההתוך |
167-174℃ |
| נקודת רתיחה |
274°C at 760 mmHg |
| משקל סגולי |
1.642 |
| נקודת הבזק |
119.5°C |
| Hazard סימנים |
 C:Corrosive;
|
| סיכונים קודי |
R34:Causes burns.;
|
| בטיחות תיאור |
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
