ChemNet > CAS > 937-63-3 p-Tolyl chlorothionoformate
937-63-3 p-Tolyl chlorothionoformate
שם המוצר |
p-Tolyl chlorothionoformate |
נרדפות |
p-Tolyl chlorothioformate; O-(4-methylphenyl) carbonochloridothioate |
מולקולרית פורמולה |
C8H7ClOS |
משקל מולקולרי |
186.6586 |
InChI |
InChI=1/C8H7ClOS/c1-6-2-4-7(5-3-6)10-8(9)11/h2-5H,1H3 |
מספר CAS |
937-63-3 |
EINECS |
213-333-3 |
מבנה מולקולרי |
|
צפיפות |
1.277g/cm3 |
נקודת רתיחה |
244.8°C at 760 mmHg |
משקל סגולי |
1.598 |
נקודת הבזק |
101.8°C |
Hazard סימנים |
|
סיכונים קודי |
R34:Causes burns.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|