ChemNet > CAS > 937-64-4 4-chlorophenyl chlorothionoformate
937-64-4 4-chlorophenyl chlorothionoformate
שם המוצר |
4-chlorophenyl chlorothionoformate |
נרדפות |
O-(4-Chlorophenyl chlorothioformate); O-(4-chlorophenyl) carbonochloridothioate; 4-chlorophenyl chlorothioformate |
מולקולרית פורמולה |
C7H4Cl2OS |
משקל מולקולרי |
207.0771 |
InChI |
InChI=1/C7H4Cl2OS/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H |
מספר CAS |
937-64-4 |
EINECS |
213-334-9 |
מבנה מולקולרי |
|
צפיפות |
1.46g/cm3 |
נקודת רתיחה |
251.7°C at 760 mmHg |
משקל סגולי |
1.622 |
נקודת הבזק |
106°C |
Hazard סימנים |
|
סיכונים קודי |
R34:Causes burns.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|