ChemNet > CAS > 95735-63-0 2-(3,4-Dimethoxyphenylthio)acetic acid
95735-63-0 2-(3,4-Dimethoxyphenylthio)acetic acid
שם המוצר |
2-(3,4-Dimethoxyphenylthio)acetic acid |
נרדפות |
2-[(3,4-dimethoxyphenyl)thio]acetic acid; [(3,4-dimethoxyphenyl)sulfanyl]acetic acid; [(3,4-dimethoxyphenyl)sulfanyl]acetate |
מולקולרית פורמולה |
C10H11O4S |
משקל מולקולרי |
227.2575 |
InChI |
InChI=1/C10H12O4S/c1-13-8-4-3-7(5-9(8)14-2)15-6-10(11)12/h3-5H,6H2,1-2H3,(H,11,12)/p-1 |
מספר CAS |
95735-63-0 |
מבנה מולקולרי |
|
נקודת ההתוך |
101-103℃ |
נקודת רתיחה |
376.4°C at 760 mmHg |
נקודת הבזק |
181.4°C |
Hazard סימנים |
Xi:Irritant;
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|