ChemNet > CAS > 96994-73-9 2-dimethylamino-6-fluorobenzonitrile
96994-73-9 2-dimethylamino-6-fluorobenzonitrile
| שם המוצר |
2-dimethylamino-6-fluorobenzonitrile |
| מולקולרית פורמולה |
C9H9FN2 |
| משקל מולקולרי |
164.1796 |
| InChI |
InChI=1/C9H9FN2/c1-12(2)9-5-3-4-8(10)7(9)6-11/h3-5H,1-2H3 |
| מספר CAS |
96994-73-9 |
| מבנה מולקולרי |
|
| צפיפות |
1.13g/cm3 |
| נקודת רתיחה |
267.4°C at 760 mmHg |
| משקל סגולי |
1.53 |
| נקודת הבזק |
115.5°C |
| Hazard סימנים |
 Xn:Harmful;
|
| סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
