ChemNet > CAS > 1000-86-8 2,4-Dimethyl-1,3-pentadiene
1000-86-8 2,4-Dimethyl-1,3-pentadiene
| उत्पाद का नाम |
2,4-Dimethyl-1,3-pentadiene |
| समानार्थी |
2,4-Dimethylpenta-1,3-diene; 1,1,3-Trimethylbutadiene; NSC 123451; 1,3-Pentadiene, 2,4-dimethyl- (8CI)(9CI) |
| आणविक फार्मूला |
C7H12 |
| आण्विक वजन |
96.1702 |
| InChI |
InChI=1/C7H12/c1-6(2)5-7(3)4/h5H,1H2,2-4H3 |
| कैस रजिस्टी संख्या |
1000-86-8 |
| EINECS |
213-677-4 |
| आणविक संरचना |
|
| घनत्व |
0.726g/cm3 |
| उबलने का समय |
93.2°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.426 |
| फ्लैश प्वाइंट |
10°C |
| खतरा प्रतीक |
 F:Highly flammable;
 Xi:Irritant;
|
| खतरे के कोड |
R11:Highly flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S16:Keep away from sources of ignition - No smoking.;
S24/25:Avoid contact with skin and eyes.;
|
|
