ChemNet > CAS > 104-18-7 (4-Aminophenylthio)acetic acid
104-18-7 (4-Aminophenylthio)acetic acid
| उत्पाद का नाम |
(4-Aminophenylthio)acetic acid |
| समानार्थी |
2-(4-Aminophenylthio)acetic acid; 4-Aminothiophenoxyacetic acid; [(4-aminophenyl)sulfanyl]acetic acid; [(4-aminophenyl)sulfanyl]acetate |
| आणविक फार्मूला |
C8H8NO2S |
| आण्विक वजन |
182.2202 |
| InChI |
InChI=1/C8H9NO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5,9H2,(H,10,11)/p-1 |
| कैस रजिस्टी संख्या |
104-18-7 |
| EINECS |
203-182-1 |
| आणविक संरचना |
|
| उबलने का समय |
405.3°C at 760 mmHg |
| फ्लैश प्वाइंट |
198.9°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
