ChemNet > CAS > 104-40-5 4-n-Nonylphenol
104-40-5 4-n-Nonylphenol
| उत्पाद का नाम |
4-n-Nonylphenol |
| समानार्थी |
1-(4-Hydroxyphenyl)nonane; 4-nonylphenol; 2-nonylphenol |
| आणविक फार्मूला |
C15H24O |
| आण्विक वजन |
220.3505 |
| InChI |
InChI=1/C15H24O/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15(14)16/h9-10,12-13,16H,2-8,11H2,1H3 |
| कैस रजिस्टी संख्या |
104-40-5 |
| EINECS |
203-199-4 |
| आणविक संरचना |
|
| घनत्व |
0.932g/cm3 |
| उबलने का समय |
321.3°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.505 |
| फ्लैश प्वाइंट |
177.5°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R22:Harmful if swallowed.;
R34:Causes burns.;
R52/53:Harmful to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|
