ChemNet > CAS > 10531-43-8 2-bromo-1-(5-phenyl-2-thienyl)-1-ethanone
10531-43-8 2-bromo-1-(5-phenyl-2-thienyl)-1-ethanone
उत्पाद का नाम |
2-bromo-1-(5-phenyl-2-thienyl)-1-ethanone |
समानार्थी |
2-bromo-1-(5-phenylthiophen-2-yl)ethanone |
आणविक फार्मूला |
C12H9BrOS |
आण्विक वजन |
281.1683 |
InChI |
InChI=1/C12H9BrOS/c13-8-10(14)12-7-6-11(15-12)9-4-2-1-3-5-9/h1-7H,8H2 |
कैस रजिस्टी संख्या |
10531-43-8 |
आणविक संरचना |
|
घनत्व |
1.488g/cm3 |
उबलने का समय |
407.1°C at 760 mmHg |
अपवर्तक सूचकांक |
1.627 |
फ्लैश प्वाइंट |
200°C |
खतरा प्रतीक |
Xi:Irritant;
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|