ChemNet > CAS > 10570-67-9 4-iodo-2,6-dimethylphenol
10570-67-9 4-iodo-2,6-dimethylphenol
| उत्पाद का नाम |
4-iodo-2,6-dimethylphenol |
| समानार्थी |
2,6-Dimethyl-4-iodophenol; 4-IODO-2,6-XYLENOL; 4-lodo-2,6-dimethyl phenol |
| आणविक फार्मूला |
C8H9IO |
| आण्विक वजन |
248.0609 |
| InChI |
InChI=1/C8H9IO/c1-5-3-7(9)4-6(2)8(5)10/h3-4,10H,1-2H3 |
| कैस रजिस्टी संख्या |
10570-67-9 |
| आणविक संरचना |
|
| घनत्व |
1.74g/cm3 |
| गलनांक |
96℃ |
| उबलने का समय |
278.9°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.629 |
| फ्लैश प्वाइंट |
122.5°C |
| खतरा प्रतीक |
 Xi:Irritant;
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
