ChemNet > CAS > 111787-91-8 (2-methyl-5-phenyl-3-furyl)methanol
111787-91-8 (2-methyl-5-phenyl-3-furyl)methanol
उत्पाद का नाम |
(2-methyl-5-phenyl-3-furyl)methanol |
समानार्थी |
(2-methyl-5-phenylfuran-3-yl)methanol |
आणविक फार्मूला |
C12H12O2 |
आण्विक वजन |
188.2225 |
InChI |
InChI=1/C12H12O2/c1-9-11(8-13)7-12(14-9)10-5-3-2-4-6-10/h2-7,13H,8H2,1H3 |
कैस रजिस्टी संख्या |
111787-91-8 |
आणविक संरचना |
|
घनत्व |
1.123g/cm3 |
गलनांक |
22℃ |
उबलने का समय |
233.9°C at 760 mmHg |
अपवर्तक सूचकांक |
1.562 |
फ्लैश प्वाइंट |
95.2°C |
खतरा प्रतीक |
Xi:Irritant;
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|