ChemNet > CAS > 1135-12-2 4-Aminodiphenylmethane
1135-12-2 4-Aminodiphenylmethane
उत्पाद का नाम |
4-Aminodiphenylmethane |
समानार्थी |
4-Benzylaniline; 1,1,2,2-tetramethyl-3,4-di(propan-2-ylidene)cyclobutane |
आणविक फार्मूला |
C13H13N |
आण्विक वजन |
183.249 |
InChI |
InChI=1/C13H13N/c14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9H,10,14H2 |
कैस रजिस्टी संख्या |
1135-12-2 |
आणविक संरचना |
|
घनत्व |
1.07g/cm3 |
उबलने का समय |
300°C at 760 mmHg |
अपवर्तक सूचकांक |
1.616 |
फ्लैश प्वाइंट |
159.5°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|