ChemNet > CAS > 116632-39-4 Bromoiodotoluene
116632-39-4 Bromoiodotoluene
उत्पाद का नाम |
Bromoiodotoluene |
समानार्थी |
5-Bromo-2-iodotoluene; 4-bromo-1-iodo-2-methylbenzene |
आणविक फार्मूला |
C7H6BrI |
आण्विक वजन |
296.931 |
InChI |
InChI=1/C7H6BrI/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
कैस रजिस्टी संख्या |
116632-39-4 |
आणविक संरचना |
|
घनत्व |
2.062g/cm3 |
उबलने का समय |
264.2°C at 760 mmHg |
अपवर्तक सूचकांक |
1.636 |
फ्लैश प्वाइंट |
113.6°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/38:Irritating to eyes and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|