ChemNet > CAS > 1190-92-7 1-Dimethylamino-2-nitroethylene
1190-92-7 1-Dimethylamino-2-nitroethylene
| उत्पाद का नाम |
1-Dimethylamino-2-nitroethylene |
| समानार्थी |
1-(dimethylamino)-2-nitroethylene; (E)-N,N-dimethyl-2-nitroethenamine; 1-Nitro-2-(dimethylamino)ethylene |
| आणविक फार्मूला |
C4H8N2O2 |
| आण्विक वजन |
116.1185 |
| InChI |
InChI=1/C4H8N2O2/c1-5(2)3-4-6(7)8/h3-4H,1-2H3/b4-3+ |
| कैस रजिस्टी संख्या |
1190-92-7 |
| आणविक संरचना |
|
| घनत्व |
1.073g/cm3 |
| उबलने का समय |
161.1°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.473 |
| फ्लैश प्वाइंट |
51.2°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
