ChemNet > CAS > 1197-19-9 4-(Dimethylamino)benzonitrile
1197-19-9 4-(Dimethylamino)benzonitrile
उत्पाद का नाम |
4-(Dimethylamino)benzonitrile |
समानार्थी |
4-Dimethylaminobenzonitrile; 4-Cyano-NN-dimethylaniline |
आणविक फार्मूला |
C9H10N2 |
आण्विक वजन |
146.1891 |
InChI |
InChI=1/C9H10N2/c1-11(2)9-5-3-8(7-10)4-6-9/h3-6H,1-2H3 |
कैस रजिस्टी संख्या |
1197-19-9 |
EINECS |
214-819-8 |
आणविक संरचना |
|
घनत्व |
1.04g/cm3 |
गलनांक |
70-76℃ |
उबलने का समय |
318.8°C at 760 mmHg |
अपवर्तक सूचकांक |
1.55 |
फ्लैश प्वाइंट |
145.4°C |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
सुरक्षा विवरण |
S36/37:Wear suitable protective clothing and gloves.;
|
|