ChemNet > CAS > 123971-45-9 4-(5-chloro-2-thienyl)-1,3-thiazol-2-amine
123971-45-9 4-(5-chloro-2-thienyl)-1,3-thiazol-2-amine
उत्पाद का नाम |
4-(5-chloro-2-thienyl)-1,3-thiazol-2-amine |
समानार्थी |
2-Amino-4-(5-chlorothien-2-yl)thiazole; 4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-amine |
आणविक फार्मूला |
C7H5ClN2S2 |
आण्विक वजन |
216.711 |
InChI |
InChI=1/C7H5ClN2S2/c8-6-2-1-5(12-6)4-3-11-7(9)10-4/h1-3H,(H2,9,10) |
कैस रजिस्टी संख्या |
123971-45-9 |
आणविक संरचना |
|
घनत्व |
1.535g/cm3 |
गलनांक |
129℃ |
उबलने का समय |
386°C at 760 mmHg |
अपवर्तक सूचकांक |
1.704 |
फ्लैश प्वाइंट |
187.2°C |
खतरा प्रतीक |
|
खतरे के कोड |
|
सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|