ChemNet > CAS > 124-48-1 Chlorodibromomethane
124-48-1 Chlorodibromomethane
| उत्पाद का नाम |
Chlorodibromomethane |
| समानार्थी |
Dibromochloromethane |
| आणविक फार्मूला |
CHBr2Cl |
| आण्विक वजन |
208.2796 |
| InChI |
InChI=1/CHBr2Cl/c2-1(3)4/h1H |
| कैस रजिस्टी संख्या |
124-48-1 |
| EINECS |
204-704-0 |
| आणविक संरचना |
|
| घनत्व |
2.504g/cm3 |
| गलनांक |
-22℃ |
| उबलने का समय |
117.1°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.561 |
| फ्लैश प्वाइंट |
19.8°C |
| खतरा प्रतीक |
 Xn:Harmful;
|
| खतरे के कोड |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R40:Possible risks of irreversible effects.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
