ChemNet > CAS > 133082-13-0 (S)-(+)-1-(2-chlorophenyl)-1,2-ethanediol
133082-13-0 (S)-(+)-1-(2-chlorophenyl)-1,2-ethanediol
उत्पाद का नाम |
(S)-(+)-1-(2-chlorophenyl)-1,2-ethanediol |
समानार्थी |
(1S)-1-(2-Chlorophenyl)ethane-1,2-diol |
आणविक फार्मूला |
C8H9ClO2 |
आण्विक वजन |
172.6089 |
InChI |
InChI=1/C8H9ClO2/c9-7-4-2-1-3-6(7)8(11)5-10/h1-4,8,10-11H,5H2/t8-/m1/s1 |
कैस रजिस्टी संख्या |
133082-13-0 |
आणविक संरचना |
|
घनत्व |
1.328g/cm3 |
गलनांक |
68-75℃ |
उबलने का समय |
322°C at 760 mmHg |
अपवर्तक सूचकांक |
1.588 |
फ्लैश प्वाइंट |
148.5°C |
खतरा प्रतीक |
Xi:Irritant;
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|