ChemNet > CAS > 13388-75-5 3,5-Dimethoxyphenylacetonitrile
13388-75-5 3,5-Dimethoxyphenylacetonitrile
उत्पाद का नाम |
3,5-Dimethoxyphenylacetonitrile |
आणविक फार्मूला |
C10H11NO2 |
आण्विक वजन |
177.1998 |
InChI |
InChI=1/C10H11NO2/c1-12-9-5-8(3-4-11)6-10(7-9)13-2/h5-7H,3H2,1-2H3 |
कैस रजिस्टी संख्या |
13388-75-5 |
EINECS |
202-225-1 |
आणविक संरचना |
|
घनत्व |
1.082g/cm3 |
उबलने का समय |
316.7°C at 760 mmHg |
अपवर्तक सूचकांक |
1.511 |
फ्लैश प्वाइंट |
127.3°C |
खतरा प्रतीक |
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
सुरक्षा विवरण |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|