ChemNet > CAS > 13455-00-0 Diphosphorus tetraiodide
13455-00-0 Diphosphorus tetraiodide
उत्पाद का नाम |
Diphosphorus tetraiodide |
समानार्थी |
Phosphorus diiodide; tetraiododiphosphane |
आणविक फार्मूला |
I4P2 |
आण्विक वजन |
569.5654 |
InChI |
InChI=1/I4P2/c1-5(2)6(3)4 |
कैस रजिस्टी संख्या |
13455-00-0 |
EINECS |
236-646-7 |
आणविक संरचना |
|
गलनांक |
125-128℃ |
खतरा प्रतीक |
C:Corrosive;
|
खतरे के कोड |
R34:Causes burns.;
|
सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
S7/9:Keep container tightly closed and in a well-ventilated place.;
|
|