ChemNet > CAS > 135-01-3 1,2-diethylbenzene
135-01-3 1,2-diethylbenzene
उत्पाद का नाम |
1,2-diethylbenzene |
समानार्थी |
Diethylbenzene; o-Diethylbenzene |
आणविक फार्मूला |
C10H14 |
आण्विक वजन |
134.2182 |
InChI |
InChI=1/C10H14/c1-3-9-7-5-6-8-10(9)4-2/h5-8H,3-4H2,1-2H3 |
कैस रजिस्टी संख्या |
135-01-3 |
EINECS |
205-170-1 |
आणविक संरचना |
|
घनत्व |
0.865g/cm3 |
उबलने का समय |
183.5°C at 760 mmHg |
अपवर्तक सूचकांक |
1.496 |
फ्लैश प्वाइंट |
49.4°C |
खतरा प्रतीक |
|
खतरे के कोड |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|