ChemNet > CAS > 14444-77-0 Diethyl phenyl orthoformate
14444-77-0 Diethyl phenyl orthoformate
| उत्पाद का नाम |
Diethyl phenyl orthoformate |
| समानार्थी |
Orthoformic acid diethyl phenyl ester; (diethoxymethoxy)benzene |
| आणविक फार्मूला |
C11H16O3 |
| आण्विक वजन |
196.2429 |
| InChI |
InChI=1/C11H16O3/c1-3-12-11(13-4-2)14-10-8-6-5-7-9-10/h5-9,11H,3-4H2,1-2H3 |
| कैस रजिस्टी संख्या |
14444-77-0 |
| EINECS |
238-421-9 |
| आणविक संरचना |
|
| घनत्व |
1.019g/cm3 |
| उबलने का समय |
235.2°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.482 |
| फ्लैश प्वाइंट |
57.2°C |
| खतरा प्रतीक |
 Xi:Irritant;
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|
