ChemNet > CAS > 145689-34-5 2,3-difluorophenylacetonitrile
145689-34-5 2,3-difluorophenylacetonitrile
| उत्पाद का नाम |
2,3-difluorophenylacetonitrile |
| समानार्थी |
2,3-Difluorobenzylcyanide; 2,3-difluorophenylacetanitrile |
| आणविक फार्मूला |
C8H5F2N |
| आण्विक वजन |
153.1288 |
| InChI |
InChI=1/C8H5F2N/c9-7-3-1-2-6(4-5-11)8(7)10/h1-3H,4H2 |
| कैस रजिस्टी संख्या |
145689-34-5 |
| आणविक संरचना |
|
| घनत्व |
1.234g/cm3 |
| उबलने का समय |
216.9°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.487 |
| फ्लैश प्वाइंट |
85°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| सुरक्षा विवरण |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
