ChemNet > CAS > 1526-17-6 2-fluoro-6-nitrophenol
1526-17-6 2-fluoro-6-nitrophenol
उत्पाद का नाम |
2-fluoro-6-nitrophenol |
समानार्थी |
2-nitro-6-fluorophenol; Phenol, 2-fluoro-6-nitro- |
आणविक फार्मूला |
C6H4FNO3 |
आण्विक वजन |
157.1 |
InChI |
InChI=1/C6H4FNO3/c7-4-2-1-3-5(6(4)9)8(10)11/h1-3,9H |
कैस रजिस्टी संख्या |
1526-17-6 |
EINECS |
216-199-4 |
आणविक संरचना |
|
खतरा प्रतीक |
|
खतरे के कोड |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|