ChemNet > CAS > 1631-83-0 Diphenylchlorosilane
1631-83-0 Diphenylchlorosilane
उत्पाद का नाम |
Diphenylchlorosilane |
समानार्थी |
Chlorodiphenylsilane; chloro(diphenyl)silyl |
आणविक फार्मूला |
C12H10ClSi |
आण्विक वजन |
217.7463 |
InChI |
InChI=1/C12H10ClSi/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
कैस रजिस्टी संख्या |
1631-83-0 |
EINECS |
216-634-8 |
आणविक संरचना |
|
खतरा प्रतीक |
|
खतरे के कोड |
R34:Causes burns.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|