ChemNet > CAS > 167415-27-2 1-Bromo-2,5-difluoro-4-nitrobenzene
167415-27-2 1-Bromo-2,5-difluoro-4-nitrobenzene
| उत्पाद का नाम |
1-Bromo-2,5-difluoro-4-nitrobenzene |
| समानार्थी |
4-Bromo-2,5-difluoronitrobenzene |
| आणविक फार्मूला |
C6H2BrF2NO2 |
| आण्विक वजन |
237.9864 |
| InChI |
InChI=1/C6H2BrF2NO2/c7-3-1-5(9)6(10(11)12)2-4(3)8/h1-2H |
| कैस रजिस्टी संख्या |
167415-27-2 |
| आणविक संरचना |
|
| घनत्व |
1.89g/cm3 |
| उबलने का समय |
262.4°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.556 |
| फ्लैश प्वाइंट |
112.5°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
