ChemNet > CAS > 170230-87-2 4-Amino-3-ethylbenzonitrile
170230-87-2 4-Amino-3-ethylbenzonitrile
| उत्पाद का नाम |
4-Amino-3-ethylbenzonitrile |
| समानार्थी |
4-Cyano-2-ethylaniline |
| आणविक फार्मूला |
C9H10N2 |
| आण्विक वजन |
146.1891 |
| InChI |
InChI=1/C9H10N2/c1-2-8-5-7(6-10)3-4-9(8)11/h3-5H,2,11H2,1H3 |
| कैस रजिस्टी संख्या |
170230-87-2 |
| आणविक संरचना |
|
| घनत्व |
1.07g/cm3 |
| उबलने का समय |
297.1°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.562 |
| फ्लैश प्वाइंट |
133.5°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| सुरक्षा विवरण |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
