ChemNet > CAS > 183158-34-1 2,3-Dimethylbenzeneboronic acid
183158-34-1 2,3-Dimethylbenzeneboronic acid
| उत्पाद का नाम |
2,3-Dimethylbenzeneboronic acid |
| समानार्थी |
2,3-Dimethylphenylboronic acid; O-XYLENE-3-BORONIC ACID; 2,3-dimethyl acid |
| आणविक फार्मूला |
C8H11BO2 |
| आण्विक वजन |
149.9827 |
| InChI |
InChI=1/C8H11BO2/c1-6-4-3-5-8(7(6)2)9(10)11/h3-5,10-11H,1-2H3 |
| कैस रजिस्टी संख्या |
183158-34-1 |
| आणविक संरचना |
|
| घनत्व |
1.07g/cm3 |
| गलनांक |
174-180℃ |
| उबलने का समय |
312.6°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.523 |
| फ्लैश प्वाइंट |
142.8°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
