ChemNet > CAS > 18536-91-9 Dodecyltriethoxysilane
18536-91-9 Dodecyltriethoxysilane
उत्पाद का नाम |
Dodecyltriethoxysilane |
समानार्थी |
n-Dodecyltriethoxysilane; n-Diethoxytrethoxysilane; hexadecane-2,15-dione |
आणविक फार्मूला |
C16H30O2 |
आण्विक वजन |
254.4082 |
InChI |
InChI=1/C16H30O2/c1-15(17)13-11-9-7-5-3-4-6-8-10-12-14-16(2)18/h3-14H2,1-2H3 |
कैस रजिस्टी संख्या |
18536-91-9 |
EINECS |
242-409-9 |
आणविक संरचना |
|
घनत्व |
0.886g/cm3 |
उबलने का समय |
353.1°C at 760 mmHg |
अपवर्तक सूचकांक |
1.444 |
फ्लैश प्वाइंट |
132.5°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/38:Irritating to eyes and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|