ChemNet > CAS > 191-07-1 Coronene
191-07-1 Coronene
उत्पाद का नाम |
Coronene |
समानार्थी |
Hexabenzobenzene; Coronene (purity) |
आणविक फार्मूला |
C24H12 |
आण्विक वजन |
300.3521 |
InChI |
InChI=1/C24H12/c1-2-14-5-6-16-9-11-18-12-10-17-8-7-15-4-3-13(1)19-20(14)22(16)24(18)23(17)21(15)19/h1-12H |
कैस रजिस्टी संख्या |
191-07-1 |
EINECS |
205-881-7 |
आणविक संरचना |
|
घनत्व |
1.467g/cm3 |
गलनांक |
438-440℃ |
उबलने का समय |
525.6°C at 760 mmHg |
अपवर्तक सूचकांक |
2.139 |
फ्लैश प्वाइंट |
265.2°C |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
सुरक्षा विवरण |
S36/37:Wear suitable protective clothing and gloves.;
|
|