ChemNet > CAS > 2005-08-5 4-chlorophenyl benzoate
2005-08-5 4-chlorophenyl benzoate
उत्पाद का नाम |
4-chlorophenyl benzoate |
समानार्थी |
4-Chlorophenyl benzoate; benzoic acid 4-chlorophenyl ester |
आणविक फार्मूला |
C13H9ClO2 |
आण्विक वजन |
232.6624 |
InChI |
InChI=1/C13H9ClO2/c14-11-6-8-12(9-7-11)16-13(15)10-4-2-1-3-5-10/h1-9H |
कैस रजिस्टी संख्या |
2005-08-5 |
EINECS |
217-910-0 |
आणविक संरचना |
|
घनत्व |
1.258g/cm3 |
गलनांक |
87-89℃ |
उबलने का समय |
343.1°C at 760 mmHg |
अपवर्तक सूचकांक |
1.594 |
फ्लैश प्वाइंट |
175.5°C |
खतरा प्रतीक |
|
खतरे के कोड |
|
सुरक्षा विवरण |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|