ChemNet > CAS > 20300-02-1 Thiophene-2-thiocarboxamide
20300-02-1 Thiophene-2-thiocarboxamide
उत्पाद का नाम |
Thiophene-2-thiocarboxamide |
समानार्थी |
Thiophene-2-carbothioamide |
आणविक फार्मूला |
C5H5NS2 |
आण्विक वजन |
143.2299 |
InChI |
InChI=1/C5H5NS2/c6-5(7)4-2-1-3-8-4/h1-3H,(H2,6,7) |
कैस रजिस्टी संख्या |
20300-02-1 |
आणविक संरचना |
|
घनत्व |
1.357g/cm3 |
गलनांक |
106℃ |
उबलने का समय |
259.5°C at 760 mmHg |
अपवर्तक सूचकांक |
1.701 |
फ्लैश प्वाइंट |
110.7°C |
खतरा प्रतीक |
Xi:Irritant;
|
खतरे के कोड |
R25:Toxic if swallowed.;
|
सुरक्षा विवरण |
S22:Do not inhale dust.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|