ChemNet > CAS > 206761-91-3 2,4,6-(trifluorophenyl)isothiocyanate
206761-91-3 2,4,6-(trifluorophenyl)isothiocyanate
| उत्पाद का नाम |
2,4,6-(trifluorophenyl)isothiocyanate |
| समानार्थी |
2,4,6-Trifluorophenyl isothiocyanate; 1,3,5-trifluoro-2-isothiocyanatobenzene |
| आणविक फार्मूला |
C7H2F3NS |
| आण्विक वजन |
189.1577 |
| InChI |
InChI=1/C7H2F3NS/c8-4-1-5(9)7(11-3-12)6(10)2-4/h1-2H |
| कैस रजिस्टी संख्या |
206761-91-3 |
| आणविक संरचना |
|
| घनत्व |
1.36g/cm3 |
| उबलने का समय |
213.9°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.52 |
| फ्लैश प्वाइंट |
83.1°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
