ChemNet > CAS > 208173-21-1 4-fluoro-2-(trifluoromethyl)acetophenone
208173-21-1 4-fluoro-2-(trifluoromethyl)acetophenone
| उत्पाद का नाम |
4-fluoro-2-(trifluoromethyl)acetophenone |
| समानार्थी |
4'-fluoro-2'-(trifluoromethyl)acetophenone; 1-[4-fluoro-2-(trifluoromethyl)phenyl]ethanone; 4'-Fluoro-2'-trifluoromethylacetophenone; 4-Fluoro-2-trifluoromethylacetophenone |
| आणविक फार्मूला |
C9H9FO2 |
| आण्विक वजन |
168.165 |
| InChI |
InChI=1/C9H9FO2/c1-6(11)7-3-4-8(10)9(5-7)12-2/h3-5H,1-2H3 |
| कैस रजिस्टी संख्या |
208173-21-1 |
| आणविक संरचना |
|
| घनत्व |
1.127g/cm3 |
| उबलने का समय |
246°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.487 |
| फ्लैश प्वाइंट |
99.6°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/38:Irritating to eyes and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
